C20H21BrN2O2 — CID 90010681
N-(4-bromophenyl)-2-(cyclohexanecarbonylamino)benzamide (PubChem CID 90010681) has the molecular formula C20H21BrN2O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(cyclohexanecarbonylamino)benzamide.
| Compound Name | N-(4-bromophenyl)-2-(cyclohexanecarbonylamino)benzamide |
|---|---|
| PubChem CID | 90010681 |
| Molecular Formula | C20H21BrN2O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-(4-bromophenyl)-2-(cyclohexanecarbonylamino)benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1ccccc1NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H21BrN2O2/c21-15-10-12-16(13-11-15)22-20(25)17-8-4-5-9-18(17)23-19(24)14-6-2-1-3-7-14/h4-5,8-14H,1-3,6-7H2,(H,22,25)(H,23,24) |
| InChIKey | HFKJIUZNICBOTK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |