C21H26ClN3O3 — CID 119945563
2-amino-N-[3-(cyclohexanecarbonylamino)-4-methoxyphenyl]benzamide;hydrochloride (PubChem CID 119945563) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 2-amino-N-[3-(cyclohexanecarbonylamino)-4-methoxyphenyl]benzamide;hydrochloride.
| Compound Name | 2-amino-N-[3-(cyclohexanecarbonylamino)-4-methoxyphenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119945563 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-amino-N-[3-(cyclohexanecarbonylamino)-4-methoxyphenyl]benzamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)c2ccccc2N)cc1NC(=O)C1CCCCC1.Cl |
| InChI | InChI=1S/C21H25N3O3.ClH/c1-27-19-12-11-15(23-21(26)16-9-5-6-10-17(16)22)13-18(19)24-20(25)14-7-3-2-4-8-14;/h5-6,9-14H,2-4,7-8,22H2,1H3,(H,23,26)(H,24,25);1H |
| InChIKey | WZTAIVNLDMUVNP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|