C22H27N3O3 — CID 119327991
N-[5-[(2-amino-2-phenylacetyl)amino]-2-methoxyphenyl]cyclohexanecarboxamide (PubChem CID 119327991) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[5-[(2-amino-2-phenylacetyl)amino]-2-methoxyphenyl]cyclohexanecarboxamide.
| Compound Name | N-[5-[(2-amino-2-phenylacetyl)amino]-2-methoxyphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 119327991 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-[5-[(2-amino-2-phenylacetyl)amino]-2-methoxyphenyl]cyclohexanecarboxamide |
| SMILES | COc1ccc(NC(=O)C(N)c2ccccc2)cc1NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C22H27N3O3/c1-28-19-13-12-17(24-22(27)20(23)15-8-4-2-5-9-15)14-18(19)25-21(26)16-10-6-3-7-11-16/h2,4-5,8-9,12-14,16,20H,3,6-7,10-11,23H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BEZKQUOTDOJAPY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |