C23H28N2O5 — CID 51370675
N-[3-(cyclohexanecarbonylamino)-4-methoxyphenyl]-3,5-dimethoxybenzamide (PubChem CID 51370675) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[3-(cyclohexanecarbonylamino)-4-methoxyphenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-(cyclohexanecarbonylamino)-4-methoxyphenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 51370675 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[3-(cyclohexanecarbonylamino)-4-methoxyphenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(OC)c(NC(=O)C3CCCCC3)c2)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-28-18-11-16(12-19(14-18)29-2)23(27)24-17-9-10-21(30-3)20(13-17)25-22(26)15-7-5-4-6-8-15/h9-15H,4-8H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | UPXDWRBNUBNDSA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |