C25H22BrClN2O5 — CID 53267049
(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2-methyl-4-nitrophenyl)prop-2-enamide (PubChem CID 53267049) has the molecular formula C25H22BrClN2O5 and a molecular weight of 545.82 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2-methyl-4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2-methyl-4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267049 |
| Molecular Formula | C25H22BrClN2O5 |
| Molecular Weight | 545.82 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2-methyl-4-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccc([N+](=O)[O-])cc2C)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C25H22BrClN2O5/c1-3-33-23-14-17(13-20(26)25(23)34-15-18-6-4-5-7-21(18)27)8-11-24(30)28-22-10-9-19(29(31)32)12-16(22)2/h4-14H,3,15H2,1-2H3,(H,28,30)/b11-8+ |
| InChIKey | FMRFLPOSSKHTNX-DHZHZOJOSA-N |
| XLogP | 6.95 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.82 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|