C27H25BrClNO5 — CID 124523484
(2S)-2-[[(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoyl]amino]-3-phenylpropanoic acid (PubChem CID 124523484) has the molecular formula C27H25BrClNO5 and a molecular weight of 558.86 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 124523484 |
| Molecular Formula | C27H25BrClNO5 |
| Molecular Weight | 558.86 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | (2S)-2-[[(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCOc1cc(/C=C/C(=O)N[C@@H](Cc2ccccc2)C(=O)O)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H25BrClNO5/c1-2-34-24-16-19(14-21(28)26(24)35-17-20-10-6-7-11-22(20)29)12-13-25(31)30-23(27(32)33)15-18-8-4-3-5-9-18/h3-14,16,23H,2,15,17H2,1H3,(H,30,31)(H,32,33)/b13-12+/t23-/m0/s1 |
| InChIKey | CZLFTUWVZYLRKS-OTOIZHKDSA-N |
| XLogP | 5.91 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.86 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|