C26H25BrClNO5 — CID 53267069
(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 53267069) has the molecular formula C26H25BrClNO5 and a molecular weight of 546.85 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267069 |
| Molecular Formula | C26H25BrClNO5 |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(2,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccc(OC)cc2OC)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H25BrClNO5/c1-4-33-24-14-17(13-20(27)26(24)34-16-18-7-5-6-8-21(18)28)9-12-25(30)29-22-11-10-19(31-2)15-23(22)32-3/h5-15H,4,16H2,1-3H3,(H,29,30)/b12-9+ |
| InChIKey | HLZPLJTXXZXQJP-FMIVXFBMSA-N |
| XLogP | 6.75 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|