C29H30BrClN2O3 — CID 53267438
(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(4-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 53267438) has the molecular formula C29H30BrClN2O3 and a molecular weight of 569.93 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(4-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(4-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267438 |
| Molecular Formula | C29H30BrClN2O3 |
| Molecular Weight | 569.93 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(4-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccc(N3CCCCC3)cc2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C29H30BrClN2O3/c1-2-35-27-19-21(18-25(30)29(27)36-20-22-8-4-5-9-26(22)31)10-15-28(34)32-23-11-13-24(14-12-23)33-16-6-3-7-17-33/h4-5,8-15,18-19H,2-3,6-7,16-17,20H2,1H3,(H,32,34)/b15-10+ |
| InChIKey | HKKDQHVXECZCHM-XNTDXEJSSA-N |
| XLogP | 7.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.93 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|