C21H23ClN2O4 — CID 9343247
(2S)-N'-[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide (PubChem CID 9343247) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is (2S)-N'-[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9343247 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (2S)-N'-[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide |
| SMILES | CCOc1ccc(O[C@@H](C)C(=O)NNC(=O)/C=C/c2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-4-27-17-8-10-18(11-9-17)28-15(3)21(26)24-23-20(25)12-7-16-6-5-14(2)19(22)13-16/h5-13,15H,4H2,1-3H3,(H,23,25)(H,24,26)/b12-7+/t15-/m0/s1 |
| InChIKey | SKRQGNIZTGHXRA-BLMSOEDDSA-N |
| XLogP | 3.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|