C23H28N2O5 — CID 43011951
2-(2,3-dimethylphenoxy)-N'-[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]propanehydrazide (PubChem CID 43011951) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N'-[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]propanehydrazide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N'-[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 43011951 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N'-[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]propanehydrazide |
| SMILES | CCOc1cc(/C=C/C(=O)NNC(=O)C(C)Oc2cccc(C)c2C)ccc1OC |
| InChI | InChI=1S/C23H28N2O5/c1-6-29-21-14-18(10-12-20(21)28-5)11-13-22(26)24-25-23(27)17(4)30-19-9-7-8-15(2)16(19)3/h7-14,17H,6H2,1-5H3,(H,24,26)(H,25,27)/b13-11+ |
| InChIKey | QVMOROISQIOBFY-ACCUITESSA-N |
| XLogP | 3.34 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|