C22H23N3O5 — CID 55343881
N'-[(E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide (PubChem CID 55343881) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N'-[(E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide.
| Compound Name | N'-[(E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 55343881 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N'-[(E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoyl]-2-(4-ethoxyphenoxy)propanehydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)/C=C/c2ccc(OCC#N)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-3-28-18-9-11-20(12-10-18)30-16(2)22(27)25-24-21(26)13-6-17-4-7-19(8-5-17)29-15-14-23/h4-13,16H,3,15H2,1-2H3,(H,24,26)(H,25,27)/b13-6+ |
| InChIKey | ZNBHDHDMAGITPX-AWNIVKPZSA-N |
| XLogP | 2.62 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|