C17H18F3NO5S — CID 8935228
[(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 8935228) has the molecular formula C17H18F3NO5S and a molecular weight of 405.39 g/mol. Its IUPAC name is [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8935228 |
| Molecular Formula | C17H18F3NO5S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(C(F)(F)F)cc1)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18F3NO5S/c1-11(16(23)21-14-8-9-27(24,25)10-14)26-15(22)7-4-12-2-5-13(6-3-12)17(18,19)20/h2-7,11,14H,8-10H2,1H3,(H,21,23)/b7-4+/t11-,14-/m0/s1 |
| InChIKey | CEGKYURDESZNMM-VKNKMKLNSA-N |
| XLogP | 1.95 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|