C11H16BrNOS — CID 104584469
N-[1-(3-bromothiophen-2-yl)ethyl]-3-methoxycyclobutan-1-amine (PubChem CID 104584469) has the molecular formula C11H16BrNOS and a molecular weight of 290.23 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)ethyl]-3-methoxycyclobutan-1-amine.
| Compound Name | N-[1-(3-bromothiophen-2-yl)ethyl]-3-methoxycyclobutan-1-amine |
|---|---|
| PubChem CID | 104584469 |
| Molecular Formula | C11H16BrNOS |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)ethyl]-3-methoxycyclobutan-1-amine |
| SMILES | COC1CC(NC(C)c2sccc2Br)C1 |
| InChI | InChI=1S/C11H16BrNOS/c1-7(11-10(12)3-4-15-11)13-8-5-9(6-8)14-2/h3-4,7-9,13H,5-6H2,1-2H3 |
| InChIKey | XPFPDCOIWXUAPN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |