C11H17BrN2S2 — CID 105327985
[1-(3-bromothiophen-2-yl)-2-(thian-4-yl)ethyl]hydrazine (PubChem CID 105327985) has the molecular formula C11H17BrN2S2 and a molecular weight of 321.31 g/mol. Its IUPAC name is [1-(3-bromothiophen-2-yl)-2-(thian-4-yl)ethyl]hydrazine.
| Compound Name | [1-(3-bromothiophen-2-yl)-2-(thian-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105327985 |
| Molecular Formula | C11H17BrN2S2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | [1-(3-bromothiophen-2-yl)-2-(thian-4-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CCSCC1)c1sccc1Br |
| InChI | InChI=1S/C11H17BrN2S2/c12-9-3-6-16-11(9)10(14-13)7-8-1-4-15-5-2-8/h3,6,8,10,14H,1-2,4-5,7,13H2 |
| InChIKey | JNCYSKAMMXCKMP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|