C14H19F3N2S — CID 61419651
2-(1,4-thiazepan-4-yl)-2-[2-(trifluoromethyl)phenyl]ethanamine (PubChem CID 61419651) has the molecular formula C14H19F3N2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-(1,4-thiazepan-4-yl)-2-[2-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-(1,4-thiazepan-4-yl)-2-[2-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 61419651 |
| Molecular Formula | C14H19F3N2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(1,4-thiazepan-4-yl)-2-[2-(trifluoromethyl)phenyl]ethanamine |
| SMILES | NCC(c1ccccc1C(F)(F)F)N1CCCSCC1 |
| InChI | InChI=1S/C14H19F3N2S/c15-14(16,17)12-5-2-1-4-11(12)13(10-18)19-6-3-8-20-9-7-19/h1-2,4-5,13H,3,6-10,18H2 |
| InChIKey | UDCDHJINTKTPCV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |