C8H14BrN3S — CID 83011912
2-(3-bromothiophen-2-yl)-2-(2,2-dimethylhydrazinyl)ethanamine (PubChem CID 83011912) has the molecular formula C8H14BrN3S and a molecular weight of 264.19 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-2-(2,2-dimethylhydrazinyl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-2-(2,2-dimethylhydrazinyl)ethanamine |
|---|---|
| PubChem CID | 83011912 |
| Molecular Formula | C8H14BrN3S |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-2-(2,2-dimethylhydrazinyl)ethanamine |
| SMILES | CN(C)NC(CN)c1sccc1Br |
| InChI | InChI=1S/C8H14BrN3S/c1-12(2)11-7(5-10)8-6(9)3-4-13-8/h3-4,7,11H,5,10H2,1-2H3 |
| InChIKey | XCAGHSICPXADEN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|