C10H17BrN2S — CID 115380264
1-(3-bromothiophen-2-yl)-N,N-diethylethane-1,2-diamine (PubChem CID 115380264) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N,N-diethylethane-1,2-diamine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N,N-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 115380264 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N,N-diethylethane-1,2-diamine |
| SMILES | CCN(CC)C(CN)c1sccc1Br |
| InChI | InChI=1S/C10H17BrN2S/c1-3-13(4-2)9(7-12)10-8(11)5-6-14-10/h5-6,9H,3-4,7,12H2,1-2H3 |
| InChIKey | QMPMTMTYOLUBQL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |