C10H17BrN2OS — CID 115381058
2-(3-bromothiophen-2-yl)-2-[2-(dimethylamino)ethylamino]ethanol (PubChem CID 115381058) has the molecular formula C10H17BrN2OS and a molecular weight of 293.23 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-2-[2-(dimethylamino)ethylamino]ethanol.
| Compound Name | 2-(3-bromothiophen-2-yl)-2-[2-(dimethylamino)ethylamino]ethanol |
|---|---|
| PubChem CID | 115381058 |
| Molecular Formula | C10H17BrN2OS |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-2-[2-(dimethylamino)ethylamino]ethanol |
| SMILES | CN(C)CCNC(CO)c1sccc1Br |
| InChI | InChI=1S/C10H17BrN2OS/c1-13(2)5-4-12-9(7-14)10-8(11)3-6-15-10/h3,6,9,12,14H,4-5,7H2,1-2H3 |
| InChIKey | DZIYIXJSJRHXBV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |