C21H25N3O5S — CID 28820708
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(1S,2S)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 28820708) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(1S,2S)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(1S,2S)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 28820708 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(1S,2S)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)NCc1ccc2c(c1)OCO2)[C@@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C21H25N3O5S/c1-14(19(18-3-2-10-30-18)24-6-8-27-9-7-24)23-21(26)20(25)22-12-15-4-5-16-17(11-15)29-13-28-16/h2-5,10-11,14,19H,6-9,12-13H2,1H3,(H,22,25)(H,23,26)/t14-,19-/m0/s1 |
| InChIKey | IIFZOFCONCABJW-LIRRHRJNSA-N |
| XLogP | 1.67 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|