C17H21N3S — CID 133215409
1-[1-(2,4-dimethylphenyl)ethyl]-3-(6-methyl-2-pyridinyl)thiourea (PubChem CID 133215409) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylphenyl)ethyl]-3-(6-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[1-(2,4-dimethylphenyl)ethyl]-3-(6-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 133215409 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-[1-(2,4-dimethylphenyl)ethyl]-3-(6-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccc(C(C)NC(=S)Nc2cccc(C)n2)c(C)c1 |
| InChI | InChI=1S/C17H21N3S/c1-11-8-9-15(12(2)10-11)14(4)19-17(21)20-16-7-5-6-13(3)18-16/h5-10,14H,1-4H3,(H2,18,19,20,21) |
| InChIKey | ANSIZKSAIYUUFF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|