C16H19N3S — CID 100744494
1-[(1R)-1-(2-methylphenyl)ethyl]-3-(6-methyl-2-pyridinyl)thiourea (PubChem CID 100744494) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 1-[(1R)-1-(2-methylphenyl)ethyl]-3-(6-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[(1R)-1-(2-methylphenyl)ethyl]-3-(6-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100744494 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-[(1R)-1-(2-methylphenyl)ethyl]-3-(6-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N[C@H](C)c2ccccc2C)n1 |
| InChI | InChI=1S/C16H19N3S/c1-11-7-4-5-9-14(11)13(3)18-16(20)19-15-10-6-8-12(2)17-15/h4-10,13H,1-3H3,(H2,17,18,19,20)/t13-/m1/s1 |
| InChIKey | GLJPEEJHFVQXND-CYBMUJFWSA-N |
| XLogP | 3.75 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|