C19H23N3O4S2 — CID 19686255
diethyl 5-[(4,6-dimethyl-2-pyridinyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19686255) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is diethyl 5-[(4,6-dimethyl-2-pyridinyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[(4,6-dimethyl-2-pyridinyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19686255 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | diethyl 5-[(4,6-dimethyl-2-pyridinyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)Nc2cc(C)cc(C)n2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C19H23N3O4S2/c1-6-25-17(23)14-12(5)15(18(24)26-7-2)28-16(14)22-19(27)21-13-9-10(3)8-11(4)20-13/h8-9H,6-7H2,1-5H3,(H2,20,21,22,27) |
| InChIKey | YFLXPPXLZPGILC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|