C13H11F3N2O3S — CID 789524
methyl 5-[(E)-1-cyanoprop-1-en-2-yl]-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate (PubChem CID 789524) has the molecular formula C13H11F3N2O3S and a molecular weight of 332.30 g/mol. Its IUPAC name is methyl 5-[(E)-1-cyanoprop-1-en-2-yl]-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-[(E)-1-cyanoprop-1-en-2-yl]-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 789524 |
| Molecular Formula | C13H11F3N2O3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | methyl 5-[(E)-1-cyanoprop-1-en-2-yl]-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(F)(F)F)sc(/C(C)=C/C#N)c1C |
| InChI | InChI=1S/C13H11F3N2O3S/c1-6(4-5-17)9-7(2)8(11(19)21-3)10(22-9)18-12(20)13(14,15)16/h4H,1-3H3,(H,18,20)/b6-4+ |
| InChIKey | YUYIGSGZNJBLDR-GQCTYLIASA-N |
| XLogP | 3.27 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|