C16H13N3O5S — CID 6129292
methyl 5-carbamoyl-2-[[(E)-2-cyano-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 6129292) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is methyl 5-carbamoyl-2-[[(E)-2-cyano-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-carbamoyl-2-[[(E)-2-cyano-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 6129292 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | methyl 5-carbamoyl-2-[[(E)-2-cyano-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)/C(C#N)=C/c2ccco2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C16H13N3O5S/c1-8-11(16(22)23-2)15(25-12(8)13(18)20)19-14(21)9(7-17)6-10-4-3-5-24-10/h3-6H,1-2H3,(H2,18,20)(H,19,21)/b9-6+ |
| InChIKey | VBIFQKKSIJECMQ-RMKNXTFCSA-N |
| XLogP | 2.08 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|