C20H18N2O7S — CID 44918791
dimethyl 5-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 44918791) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is dimethyl 5-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 44918791 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | dimethyl 5-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)c2ccc(N3C(=O)CCC3=O)cc2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C20H18N2O7S/c1-10-15(19(26)28-2)18(30-16(10)20(27)29-3)21-17(25)11-4-6-12(7-5-11)22-13(23)8-9-14(22)24/h4-7H,8-9H2,1-3H3,(H,21,25) |
| InChIKey | PNIJDBAVNYPBSN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|