C22H27N3O6S3 — CID 2390394
ethyl 4,5-dimethyl-2-[(2-methyl-5-morpholin-4-ylsulfonylbenzoyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 2390394) has the molecular formula C22H27N3O6S3 and a molecular weight of 525.67 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[(2-methyl-5-morpholin-4-ylsulfonylbenzoyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[(2-methyl-5-morpholin-4-ylsulfonylbenzoyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2390394 |
| Molecular Formula | C22H27N3O6S3 |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[(2-methyl-5-morpholin-4-ylsulfonylbenzoyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2C)sc(C)c1C |
| InChI | InChI=1S/C22H27N3O6S3/c1-5-31-21(27)18-14(3)15(4)33-20(18)24-22(32)23-19(26)17-12-16(7-6-13(17)2)34(28,29)25-8-10-30-11-9-25/h6-7,12H,5,8-11H2,1-4H3,(H2,23,24,26,32) |
| InChIKey | PCWIJGUABRIONI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|