C25H32N2O6S — CID 16509213
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate (PubChem CID 16509213) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 16509213 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)c1ccc(OC)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C25H32N2O6S/c1-4-19-11-9-10-18(2)24(19)26-23(28)17-33-25(29)20-12-13-21(32-3)22(16-20)34(30,31)27-14-7-5-6-8-15-27/h9-13,16H,4-8,14-15,17H2,1-3H3,(H,26,28) |
| InChIKey | QFEXVNAFGXNVKX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |