C15H15NO5S2 — CID 18202847
[2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-(methylsulfamoyl)benzoate (PubChem CID 18202847) has the molecular formula C15H15NO5S2 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-(methylsulfamoyl)benzoate.
| Compound Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18202847 |
| Molecular Formula | C15H15NO5S2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 4-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)OCC(=O)c2ccc(C)s2)cc1 |
| InChI | InChI=1S/C15H15NO5S2/c1-10-3-8-14(22-10)13(17)9-21-15(18)11-4-6-12(7-5-11)23(19,20)16-2/h3-8,16H,9H2,1-2H3 |
| InChIKey | NPKAERIKQJLBFE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |