C18H24N6O — CID 37109544
6-(azepan-1-yl)-N-[2-(pyrazin-2-ylamino)ethyl]pyridine-3-carboxamide (PubChem CID 37109544) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 6-(azepan-1-yl)-N-[2-(pyrazin-2-ylamino)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-(azepan-1-yl)-N-[2-(pyrazin-2-ylamino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 37109544 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 6-(azepan-1-yl)-N-[2-(pyrazin-2-ylamino)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNc1cnccn1)c1ccc(N2CCCCCC2)nc1 |
| InChI | InChI=1S/C18H24N6O/c25-18(22-10-9-21-16-14-19-7-8-20-16)15-5-6-17(23-13-15)24-11-3-1-2-4-12-24/h5-8,13-14H,1-4,9-12H2,(H,20,21)(H,22,25) |
| InChIKey | KYVUIRSZGXTHMX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|