C25H22N4O8 — CID 87094731
(2S)-2-[[(2S)-2-amino-3-[3-(3,5-dinitrobenzoyl)phenyl]propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 87094731) has the molecular formula C25H22N4O8 and a molecular weight of 506.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-[3-(3,5-dinitrobenzoyl)phenyl]propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-[3-(3,5-dinitrobenzoyl)phenyl]propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 87094731 |
| Molecular Formula | C25H22N4O8 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-[3-(3,5-dinitrobenzoyl)phenyl]propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | N[C@@H](Cc1cccc(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H22N4O8/c26-21(24(31)27-22(25(32)33)11-15-5-2-1-3-6-15)10-16-7-4-8-17(9-16)23(30)18-12-19(28(34)35)14-20(13-18)29(36)37/h1-9,12-14,21-22H,10-11,26H2,(H,27,31)(H,32,33)/t21-,22-/m0/s1 |
| InChIKey | XQGZOJVKDAZCMW-VXKWHMMOSA-N |
| XLogP | 2.42 |
| TPSA | 195.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|