C21H23IN2O4 — CID 139397639
benzyl (2S)-5-(iodoamino)-5-oxo-2-(3-phenylpropanoylamino)pentanoate (PubChem CID 139397639) has the molecular formula C21H23IN2O4 and a molecular weight of 494.33 g/mol. Its IUPAC name is benzyl (2S)-5-(iodoamino)-5-oxo-2-(3-phenylpropanoylamino)pentanoate.
| Compound Name | benzyl (2S)-5-(iodoamino)-5-oxo-2-(3-phenylpropanoylamino)pentanoate |
|---|---|
| PubChem CID | 139397639 |
| Molecular Formula | C21H23IN2O4 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | benzyl (2S)-5-(iodoamino)-5-oxo-2-(3-phenylpropanoylamino)pentanoate |
| SMILES | O=C(CC[C@H](NC(=O)CCc1ccccc1)C(=O)OCc1ccccc1)NI |
| InChI | InChI=1S/C21H23IN2O4/c22-24-20(26)14-12-18(21(27)28-15-17-9-5-2-6-10-17)23-19(25)13-11-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,23,25)(H,24,26)/t18-/m0/s1 |
| InChIKey | DXSYVGAVRLXKRO-SFHVURJKSA-N |
| XLogP | 3.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|