C9H13N3O — CID 138650359
3-amino-1-(3,5-diaminophenyl)propan-1-one (PubChem CID 138650359) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-amino-1-(3,5-diaminophenyl)propan-1-one.
| Compound Name | 3-amino-1-(3,5-diaminophenyl)propan-1-one |
|---|---|
| PubChem CID | 138650359 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-amino-1-(3,5-diaminophenyl)propan-1-one |
| SMILES | NCCC(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C9H13N3O/c10-2-1-9(13)6-3-7(11)5-8(12)4-6/h3-5H,1-2,10-12H2 |
| InChIKey | ANPJUBKCUONBCV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|