C11H12F3NO — CID 117333697
3-amino-1-[3-(2,2,2-trifluoroethyl)phenyl]propan-1-one (PubChem CID 117333697) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 3-amino-1-[3-(2,2,2-trifluoroethyl)phenyl]propan-1-one.
| Compound Name | 3-amino-1-[3-(2,2,2-trifluoroethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 117333697 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-amino-1-[3-(2,2,2-trifluoroethyl)phenyl]propan-1-one |
| SMILES | NCCC(=O)c1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO/c12-11(13,14)7-8-2-1-3-9(6-8)10(16)4-5-15/h1-3,6H,4-5,7,15H2 |
| InChIKey | MGFDIPLMCYHMPP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |