C11H13F2NO — CID 117303825
3-amino-1-[3-(2,2-difluoroethyl)phenyl]propan-1-one (PubChem CID 117303825) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 3-amino-1-[3-(2,2-difluoroethyl)phenyl]propan-1-one.
| Compound Name | 3-amino-1-[3-(2,2-difluoroethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 117303825 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-amino-1-[3-(2,2-difluoroethyl)phenyl]propan-1-one |
| SMILES | NCCC(=O)c1cccc(CC(F)F)c1 |
| InChI | InChI=1S/C11H13F2NO/c12-11(13)7-8-2-1-3-9(6-8)10(15)4-5-14/h1-3,6,11H,4-5,7,14H2 |
| InChIKey | RAHJXHGWUCQVKZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |