C12H13F3N2O3 — CID 166316232
N-(3-amino-2-hydroxy-3-oxopropyl)-3-(2,2,2-trifluoroethyl)benzamide (PubChem CID 166316232) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-3-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-3-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 166316232 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-3-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NC(=O)C(O)CNC(=O)c1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O3/c13-12(14,15)5-7-2-1-3-8(4-7)11(20)17-6-9(18)10(16)19/h1-4,9,18H,5-6H2,(H2,16,19)(H,17,20) |
| InChIKey | OILWBGZESZPGMD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |