C11H13F2NO2 — CID 117329978
2-[(1-aminocyclopropyl)methyl]-3,4-difluoro-6-methoxyphenol (PubChem CID 117329978) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-[(1-aminocyclopropyl)methyl]-3,4-difluoro-6-methoxyphenol.
| Compound Name | 2-[(1-aminocyclopropyl)methyl]-3,4-difluoro-6-methoxyphenol |
|---|---|
| PubChem CID | 117329978 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(1-aminocyclopropyl)methyl]-3,4-difluoro-6-methoxyphenol |
| SMILES | COc1cc(F)c(F)c(CC2(N)CC2)c1O |
| InChI | InChI=1S/C11H13F2NO2/c1-16-8-4-7(12)9(13)6(10(8)15)5-11(14)2-3-11/h4,15H,2-3,5,14H2,1H3 |
| InChIKey | VLYQWDXGOSHGLD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |