About (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride
(3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride (PubChem CID 117454939) has the molecular formula C10H12Cl2O3S
and a molecular weight of 283.18 g/mol. Its IUPAC name is (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride.
Analyze (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride?
The IUPAC name of (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride (CID 117454939) is (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride.
What is the SMILES notation for (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride?
The canonical SMILES for (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride is COc1c(Cl)c(C)cc(C)c1CS(=O)(=O)Cl.
What is the InChIKey of (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride?
The InChIKey is QHUGGEBAYZPPOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2O3S/c1-6-4-7(2)9(11)10(15-3)8(6)5-16(12,13)14/h4H,5H2,1-3H3.
What are the key properties of (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride?
(3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride has a molecular weight of 283.18 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-2-methoxy-4,6-dimethylphenyl)methanesulfonyl chloride is sourced from PubChem (CID 117454939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).