C12H19NO4 — CID 117355228
O-[2-[2,3-dimethoxy-4-(methoxymethyl)phenyl]ethyl]hydroxylamine (PubChem CID 117355228) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is O-[2-[2,3-dimethoxy-4-(methoxymethyl)phenyl]ethyl]hydroxylamine.
| Compound Name | O-[2-[2,3-dimethoxy-4-(methoxymethyl)phenyl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117355228 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | O-[2-[2,3-dimethoxy-4-(methoxymethyl)phenyl]ethyl]hydroxylamine |
| SMILES | COCc1ccc(CCON)c(OC)c1OC |
| InChI | InChI=1S/C12H19NO4/c1-14-8-10-5-4-9(6-7-17-13)11(15-2)12(10)16-3/h4-5H,6-8,13H2,1-3H3 |
| InChIKey | BQUFQUWVBYQBBX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|