C11H15BrO3S — CID 97056142
2-bromo-1-[[(S)-ethylsulfinyl]methyl]-3,4-dimethoxybenzene (PubChem CID 97056142) has the molecular formula C11H15BrO3S and a molecular weight of 307.21 g/mol. Its IUPAC name is 2-bromo-1-[[(S)-ethylsulfinyl]methyl]-3,4-dimethoxybenzene.
| Compound Name | 2-bromo-1-[[(S)-ethylsulfinyl]methyl]-3,4-dimethoxybenzene |
|---|---|
| PubChem CID | 97056142 |
| Molecular Formula | C11H15BrO3S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-bromo-1-[[(S)-ethylsulfinyl]methyl]-3,4-dimethoxybenzene |
| SMILES | CC[S@](=O)Cc1ccc(OC)c(OC)c1Br |
| InChI | InChI=1S/C11H15BrO3S/c1-4-16(13)7-8-5-6-9(14-2)11(15-3)10(8)12/h5-6H,4,7H2,1-3H3/t16-/m0/s1 |
| InChIKey | KTOVZJORZMJXOU-INIZCTEOSA-N |
| XLogP | 2.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |