C16H15BrO4 — CID 60529134
4-[(2-bromo-3,4-dimethoxyphenyl)methoxy]benzaldehyde (PubChem CID 60529134) has the molecular formula C16H15BrO4 and a molecular weight of 351.20 g/mol. Its IUPAC name is 4-[(2-bromo-3,4-dimethoxyphenyl)methoxy]benzaldehyde.
| Compound Name | 4-[(2-bromo-3,4-dimethoxyphenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 60529134 |
| Molecular Formula | C16H15BrO4 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 4-[(2-bromo-3,4-dimethoxyphenyl)methoxy]benzaldehyde |
| SMILES | COc1ccc(COc2ccc(C=O)cc2)c(Br)c1OC |
| InChI | InChI=1S/C16H15BrO4/c1-19-14-8-5-12(15(17)16(14)20-2)10-21-13-6-3-11(9-18)4-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | GHRCNMPZKGUQJU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|