C12H16O4 — CID 130420635
6-ethyl-5,8-dimethoxy-2,3-dihydro-1,4-benzodioxine (PubChem CID 130420635) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-ethyl-5,8-dimethoxy-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-ethyl-5,8-dimethoxy-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 130420635 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 6-ethyl-5,8-dimethoxy-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCc1cc(OC)c2c(c1OC)OCCO2 |
| InChI | InChI=1S/C12H16O4/c1-4-8-7-9(13-2)11-12(10(8)14-3)16-6-5-15-11/h7H,4-6H2,1-3H3 |
| InChIKey | ZOBDFSDMBKIBFE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |