C24H28Br4O7 — CID 11994060
3,25-dibromo-4,24-bis(bromomethyl)-6,22-dimethoxy-8,11,14,17,20-pentaoxatricyclo[19.4.0.02,7]pentacosa-1(25),2,4,6,21,23-hexaene (PubChem CID 11994060) has the molecular formula C24H28Br4O7 and a molecular weight of 748.10 g/mol. Its IUPAC name is 3,25-dibromo-4,24-bis(bromomethyl)-6,22-dimethoxy-8,11,14,17,20-pentaoxatricyclo[19.4.0.02,7]pentacosa-1(25),2,4,6,21,23-hexaene.
| Compound Name | 3,25-dibromo-4,24-bis(bromomethyl)-6,22-dimethoxy-8,11,14,17,20-pentaoxatricyclo[19.4.0.02,7]pentacosa-1(25),2,4,6,21,23-hexaene |
|---|---|
| PubChem CID | 11994060 |
| Molecular Formula | C24H28Br4O7 |
| Molecular Weight | 748.10 g/mol |
| Exact Mass | 743.86 |
| IUPAC Name | 3,25-dibromo-4,24-bis(bromomethyl)-6,22-dimethoxy-8,11,14,17,20-pentaoxatricyclo[19.4.0.02,7]pentacosa-1(25),2,4,6,21,23-hexaene |
| SMILES | COc1cc(CBr)c(Br)c2c1OCCOCCOCCOCCOc1c(OC)cc(CBr)c(Br)c1-2 |
| InChI | InChI=1S/C24H28Br4O7/c1-29-17-11-15(13-25)21(27)19-20-22(28)16(14-26)12-18(30-2)24(20)35-10-8-33-6-4-31-3-5-32-7-9-34-23(17)19/h11-12H,3-10,13-14H2,1-2H3 |
| InChIKey | BRBGIZXGQSQLQZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.10 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|