C10H11BrO3 — CID 59517213
7-bromo-9-methoxy-4,5-dihydro-1,3-benzodioxepine (PubChem CID 59517213) has the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. Its IUPAC name is 7-bromo-9-methoxy-4,5-dihydro-1,3-benzodioxepine.
| Compound Name | 7-bromo-9-methoxy-4,5-dihydro-1,3-benzodioxepine |
|---|---|
| PubChem CID | 59517213 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 7-bromo-9-methoxy-4,5-dihydro-1,3-benzodioxepine |
| SMILES | COc1cc(Br)cc2c1OCOCC2 |
| InChI | InChI=1S/C10H11BrO3/c1-12-9-5-8(11)4-7-2-3-13-6-14-10(7)9/h4-5H,2-3,6H2,1H3 |
| InChIKey | QJFYDOXCFGUBOF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |