C10H11BrO4S — CID 175517947
(6-bromo-3,4-dihydro-2H-chromen-8-yl) methanesulfonate (PubChem CID 175517947) has the molecular formula C10H11BrO4S and a molecular weight of 307.16 g/mol. Its IUPAC name is (6-bromo-3,4-dihydro-2H-chromen-8-yl) methanesulfonate.
| Compound Name | (6-bromo-3,4-dihydro-2H-chromen-8-yl) methanesulfonate |
|---|---|
| PubChem CID | 175517947 |
| Molecular Formula | C10H11BrO4S |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | (6-bromo-3,4-dihydro-2H-chromen-8-yl) methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cc(Br)cc2c1OCCC2 |
| InChI | InChI=1S/C10H11BrO4S/c1-16(12,13)15-9-6-8(11)5-7-3-2-4-14-10(7)9/h5-6H,2-4H2,1H3 |
| InChIKey | ZLAYJLNZUJNKMA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|