C14H16O5S — CID 174301224
methylsulfonyl 6-cyclopropyl-3,4-dihydro-2H-chromene-8-carboxylate (PubChem CID 174301224) has the molecular formula C14H16O5S and a molecular weight of 296.34 g/mol. Its IUPAC name is methylsulfonyl 6-cyclopropyl-3,4-dihydro-2H-chromene-8-carboxylate.
| Compound Name | methylsulfonyl 6-cyclopropyl-3,4-dihydro-2H-chromene-8-carboxylate |
|---|---|
| PubChem CID | 174301224 |
| Molecular Formula | C14H16O5S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | methylsulfonyl 6-cyclopropyl-3,4-dihydro-2H-chromene-8-carboxylate |
| SMILES | CS(=O)(=O)OC(=O)c1cc(C2CC2)cc2c1OCCC2 |
| InChI | InChI=1S/C14H16O5S/c1-20(16,17)19-14(15)12-8-11(9-4-5-9)7-10-3-2-6-18-13(10)12/h7-9H,2-6H2,1H3 |
| InChIKey | ZDPQEEPWOCYUTQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|