C9H9ClO2 — CID 84659825
8-chloro-3,4-dihydro-2H-chromen-6-ol (PubChem CID 84659825) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is 8-chloro-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | 8-chloro-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 84659825 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 8-chloro-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Oc1cc(Cl)c2c(c1)CCCO2 |
| InChI | InChI=1S/C9H9ClO2/c10-8-5-7(11)4-6-2-1-3-12-9(6)8/h4-5,11H,1-3H2 |
| InChIKey | JFYSCJIZEHZELE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |