C9H10O3 — CID 22903786
3,4-dihydro-2H-chromene-6,8-diol (PubChem CID 22903786) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene-6,8-diol.
| Compound Name | 3,4-dihydro-2H-chromene-6,8-diol |
|---|---|
| PubChem CID | 22903786 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 3,4-dihydro-2H-chromene-6,8-diol |
| SMILES | Oc1cc(O)c2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10O3/c10-7-4-6-2-1-3-12-9(6)8(11)5-7/h4-5,10-11H,1-3H2 |
| InChIKey | FKJFJIHWCXFIAB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |