C8H7FO2 — CID 11788407
5-fluoro-2,3-dihydro-1-benzofuran-7-ol (PubChem CID 11788407) has the molecular formula C8H7FO2 and a molecular weight of 154.14 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1-benzofuran-7-ol.
| Compound Name | 5-fluoro-2,3-dihydro-1-benzofuran-7-ol |
|---|---|
| PubChem CID | 11788407 |
| Molecular Formula | C8H7FO2 |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 5-fluoro-2,3-dihydro-1-benzofuran-7-ol |
| SMILES | Oc1cc(F)cc2c1OCC2 |
| InChI | InChI=1S/C8H7FO2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h3-4,10H,1-2H2 |
| InChIKey | FRNAZUFNLWZOKK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |