(2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate

C18H18O3 — CID 90702870

IUPAC(2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate
SMILESCc1cccc(OC(=O)c2cccc3c2OCCC3)c1C
InChIInChI=1S/C18H18O3/c1-12-6-3-10-16(13(12)2)21-18(19)15-9-4-7-14-8-5-11-20-17(14)15/h3-4,6-7,9-10H,5,8,11H2,1-2H3
InChIKeyTVWCSLHGWZWDHO-UHFFFAOYSA-N
MW282.34 g/mol
LogP3.85
Rot. Bonds2

About (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate

(2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate (PubChem CID 90702870) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate.

Molecular Properties

Compound Name(2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate
PubChem CID90702870
Molecular FormulaC18H18O3
Molecular Weight282.34 g/mol
Exact Mass282.13
IUPAC Name(2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate
SMILESCc1cccc(OC(=O)c2cccc3c2OCCC3)c1C
InChIInChI=1S/C18H18O3/c1-12-6-3-10-16(13(12)2)21-18(19)15-9-4-7-14-8-5-11-20-17(14)15/h3-4,6-7,9-10H,5,8,11H2,1-2H3
InChIKeyTVWCSLHGWZWDHO-UHFFFAOYSA-N
XLogP3.85
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.34
LogP ≤ 53.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate?
The IUPAC name of (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate (CID 90702870) is (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate.
What is the SMILES notation for (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate?
The canonical SMILES for (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate is Cc1cccc(OC(=O)c2cccc3c2OCCC3)c1C.
What is the InChIKey of (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate?
The InChIKey is TVWCSLHGWZWDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c1-12-6-3-10-16(13(12)2)21-18(19)15-9-4-7-14-8-5-11-20-17(14)15/h3-4,6-7,9-10H,5,8,11H2,1-2H3.
What are the key properties of (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate?
(2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate has a molecular weight of 282.34 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethylphenyl) 3,4-dihydro-2H-chromene-8-carboxylate is sourced from PubChem (CID 90702870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).