C14H20O4 — CID 59494852
[8-(3-methoxypropoxy)-3,4-dihydro-2H-chromen-6-yl]methanol (PubChem CID 59494852) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [8-(3-methoxypropoxy)-3,4-dihydro-2H-chromen-6-yl]methanol.
| Compound Name | [8-(3-methoxypropoxy)-3,4-dihydro-2H-chromen-6-yl]methanol |
|---|---|
| PubChem CID | 59494852 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [8-(3-methoxypropoxy)-3,4-dihydro-2H-chromen-6-yl]methanol |
| SMILES | COCCCOc1cc(CO)cc2c1OCCC2 |
| InChI | InChI=1S/C14H20O4/c1-16-5-3-7-17-13-9-11(10-15)8-12-4-2-6-18-14(12)13/h8-9,15H,2-7,10H2,1H3 |
| InChIKey | XFZOINVVMHSBDG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|